C16H23N4O3+ — CID 7459077
2-(4-nitrophenyl)-N-[(1-propylpiperidin-1-ium-4-ylidene)amino]acetamide (PubChem CID 7459077) has the molecular formula C16H23N4O3+ and a molecular weight of 319.38 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-N-[(1-propylpiperidin-1-ium-4-ylidene)amino]acetamide.
| Compound Name | 2-(4-nitrophenyl)-N-[(1-propylpiperidin-1-ium-4-ylidene)amino]acetamide |
|---|---|
| PubChem CID | 7459077 |
| Molecular Formula | C16H23N4O3+ |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 2-(4-nitrophenyl)-N-[(1-propylpiperidin-1-ium-4-ylidene)amino]acetamide |
| SMILES | CCC[NH+]1CCC(=NNC(=O)Cc2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C16H22N4O3/c1-2-9-19-10-7-14(8-11-19)17-18-16(21)12-13-3-5-15(6-4-13)20(22)23/h3-6H,2,7-12H2,1H3,(H,18,21)/p+1 |
| InChIKey | JIPVDUIBDJLGPY-UHFFFAOYSA-O |
| XLogP | 0.70 |
| TPSA | 89.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|