C15H24N6O4 — CID 7461280
2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-5-nitro-4-N-[[(2S)-oxolan-2-yl]methyl]pyrimidine-4,6-diamine (PubChem CID 7461280) has the molecular formula C15H24N6O4 and a molecular weight of 352.40 g/mol. Its IUPAC name is 2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-5-nitro-4-N-[[(2S)-oxolan-2-yl]methyl]pyrimidine-4,6-diamine.
| Compound Name | 2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-5-nitro-4-N-[[(2S)-oxolan-2-yl]methyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 7461280 |
| Molecular Formula | C15H24N6O4 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-5-nitro-4-N-[[(2S)-oxolan-2-yl]methyl]pyrimidine-4,6-diamine |
| SMILES | C[C@@H]1CN(c2nc(N)c([N+](=O)[O-])c(NC[C@@H]3CCCO3)n2)C[C@H](C)O1 |
| InChI | InChI=1S/C15H24N6O4/c1-9-7-20(8-10(2)25-9)15-18-13(16)12(21(22)23)14(19-15)17-6-11-4-3-5-24-11/h9-11H,3-8H2,1-2H3,(H3,16,17,18,19)/t9-,10+,11-/m0/s1 |
| InChIKey | CTUJBHUZLYGBHD-AXFHLTTASA-N |
| XLogP | 1.17 |
| TPSA | 128.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|