C18H18ClN3O — CID 74661308
6-(3-chlorophenyl)-2-phenyl-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one (PubChem CID 74661308) has the molecular formula C18H18ClN3O and a molecular weight of 327.81 g/mol. Its IUPAC name is 6-(3-chlorophenyl)-2-phenyl-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one.
| Compound Name | 6-(3-chlorophenyl)-2-phenyl-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one |
|---|---|
| PubChem CID | 74661308 |
| Molecular Formula | C18H18ClN3O |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 6-(3-chlorophenyl)-2-phenyl-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one |
| SMILES | O=C1C2CCC(c3cccc(Cl)c3)NC2NN1c1ccccc1 |
| InChI | InChI=1S/C18H18ClN3O/c19-13-6-4-5-12(11-13)16-10-9-15-17(20-16)21-22(18(15)23)14-7-2-1-3-8-14/h1-8,11,15-17,20-21H,9-10H2 |
| InChIKey | MGCIDQDZWJUGEP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |