C24H28N2O7 — CID 74686162
4-O-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 3-O,5-O-diethyl 2,6-dimethyl-3,4-dihydropyridine-3,4,5-tricarboxylate (PubChem CID 74686162) has the molecular formula C24H28N2O7 and a molecular weight of 456.50 g/mol. Its IUPAC name is 4-O-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 3-O,5-O-diethyl 2,6-dimethyl-3,4-dihydropyridine-3,4,5-tricarboxylate.
| Compound Name | 4-O-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 3-O,5-O-diethyl 2,6-dimethyl-3,4-dihydropyridine-3,4,5-tricarboxylate |
|---|---|
| PubChem CID | 74686162 |
| Molecular Formula | C24H28N2O7 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 4-O-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 3-O,5-O-diethyl 2,6-dimethyl-3,4-dihydropyridine-3,4,5-tricarboxylate |
| SMILES | CCOC(=O)C1=C(C)N=C(C)C(C(=O)OCC)C1C(=O)OCC(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C24H28N2O7/c1-5-31-22(28)19-14(3)25-15(4)20(23(29)32-6-2)21(19)24(30)33-13-18(27)26-12-11-16-9-7-8-10-17(16)26/h7-10,19,21H,5-6,11-13H2,1-4H3 |
| InChIKey | JASALOSCNYTWES-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 111.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|