C26H26O5 — CID 7468729
[2-(4-cyclohexylphenyl)-2-oxoethyl] 5-(phenoxymethyl)furan-2-carboxylate (PubChem CID 7468729) has the molecular formula C26H26O5 and a molecular weight of 418.49 g/mol. Its IUPAC name is [2-(4-cyclohexylphenyl)-2-oxoethyl] 5-(phenoxymethyl)furan-2-carboxylate.
| Compound Name | [2-(4-cyclohexylphenyl)-2-oxoethyl] 5-(phenoxymethyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 7468729 |
| Molecular Formula | C26H26O5 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | [2-(4-cyclohexylphenyl)-2-oxoethyl] 5-(phenoxymethyl)furan-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccc(COc2ccccc2)o1)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C26H26O5/c27-24(21-13-11-20(12-14-21)19-7-3-1-4-8-19)18-30-26(28)25-16-15-23(31-25)17-29-22-9-5-2-6-10-22/h2,5-6,9-16,19H,1,3-4,7-8,17-18H2 |
| InChIKey | HMASZQNQFLTFSK-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |