C18H17NO6 — CID 7468734
[2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl] 5-(phenoxymethyl)furan-2-carboxylate (PubChem CID 7468734) has the molecular formula C18H17NO6 and a molecular weight of 343.33 g/mol. Its IUPAC name is [2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl] 5-(phenoxymethyl)furan-2-carboxylate.
| Compound Name | [2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl] 5-(phenoxymethyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 7468734 |
| Molecular Formula | C18H17NO6 |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | [2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl] 5-(phenoxymethyl)furan-2-carboxylate |
| SMILES | O=C(OCC(=O)N1CCCC1=O)c1ccc(COc2ccccc2)o1 |
| InChI | InChI=1S/C18H17NO6/c20-16-7-4-10-19(16)17(21)12-24-18(22)15-9-8-14(25-15)11-23-13-5-2-1-3-6-13/h1-3,5-6,8-9H,4,7,10-12H2 |
| InChIKey | RQDQGKOSDCLSHU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |