C17H16N2O6 — CID 7468721
[2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] 5-(phenoxymethyl)furan-2-carboxylate (PubChem CID 7468721) has the molecular formula C17H16N2O6 and a molecular weight of 344.32 g/mol. Its IUPAC name is [2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] 5-(phenoxymethyl)furan-2-carboxylate.
| Compound Name | [2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] 5-(phenoxymethyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 7468721 |
| Molecular Formula | C17H16N2O6 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | [2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] 5-(phenoxymethyl)furan-2-carboxylate |
| SMILES | O=C(OCC(=O)N1CCNC1=O)c1ccc(COc2ccccc2)o1 |
| InChI | InChI=1S/C17H16N2O6/c20-15(19-9-8-18-17(19)22)11-24-16(21)14-7-6-13(25-14)10-23-12-4-2-1-3-5-12/h1-7H,8-11H2,(H,18,22) |
| InChIKey | BDVYBEOLGMIPMZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |