C13H18F3N4O+ — CID 7470004
1-(4-methylpiperazin-4-ium-1-yl)-3-[2-(trifluoromethyl)phenyl]urea (PubChem CID 7470004) has the molecular formula C13H18F3N4O+ and a molecular weight of 303.31 g/mol. Its IUPAC name is 1-(4-methylpiperazin-4-ium-1-yl)-3-[2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(4-methylpiperazin-4-ium-1-yl)-3-[2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 7470004 |
| Molecular Formula | C13H18F3N4O+ |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 1-(4-methylpiperazin-4-ium-1-yl)-3-[2-(trifluoromethyl)phenyl]urea |
| SMILES | C[NH+]1CCN(NC(=O)Nc2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H17F3N4O/c1-19-6-8-20(9-7-19)18-12(21)17-11-5-3-2-4-10(11)13(14,15)16/h2-5H,6-9H2,1H3,(H2,17,18,21)/p+1 |
| InChIKey | BOMFDNADIQUIJB-UHFFFAOYSA-O |
| XLogP | 0.57 |
| TPSA | 48.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |