C14H27N3O6 — CID 74735156
2-[3,4-dihydroxy-5-[(propan-2-ylcarbamoylamino)methyl]oxolan-2-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 74735156) has the molecular formula C14H27N3O6 and a molecular weight of 333.39 g/mol. Its IUPAC name is 2-[3,4-dihydroxy-5-[(propan-2-ylcarbamoylamino)methyl]oxolan-2-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[3,4-dihydroxy-5-[(propan-2-ylcarbamoylamino)methyl]oxolan-2-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 74735156 |
| Molecular Formula | C14H27N3O6 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 2-[3,4-dihydroxy-5-[(propan-2-ylcarbamoylamino)methyl]oxolan-2-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CC1OC(CNC(=O)NC(C)C)C(O)C1O |
| InChI | InChI=1S/C14H27N3O6/c1-8(2)17-14(21)16-7-10-13(20)12(19)9(23-10)6-11(18)15-4-5-22-3/h8-10,12-13,19-20H,4-7H2,1-3H3,(H,15,18)(H2,16,17,21) |
| InChIKey | LYANBPICHGVJHE-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 129.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|