C18H29N6O5+ — CID 74740317
ethyl 4-[[7-(2-methoxyethyl)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]methyl]piperazine-1-carboxylate (PubChem CID 74740317) has the molecular formula C18H29N6O5+ and a molecular weight of 409.47 g/mol. Its IUPAC name is ethyl 4-[[7-(2-methoxyethyl)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]methyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[[7-(2-methoxyethyl)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 74740317 |
| Molecular Formula | C18H29N6O5+ |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | ethyl 4-[[7-(2-methoxyethyl)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]methyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(CC2=[N+](CCOC)C3C(=O)N(C)C(=O)N(C)C3=N2)CC1 |
| InChI | InChI=1S/C18H29N6O5/c1-5-29-18(27)23-8-6-22(7-9-23)12-13-19-15-14(24(13)10-11-28-4)16(25)21(3)17(26)20(15)2/h14H,5-12H2,1-4H3/q+1 |
| InChIKey | LOKXIWWPEDUPKP-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 98.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|