C21H30ClN3O — CID 7474065
2-(1-adamantyl)-4-chloro-5-[[(1R,2R)-2-methylcyclohexyl]amino]pyridazin-3-one (PubChem CID 7474065) has the molecular formula C21H30ClN3O and a molecular weight of 375.94 g/mol. Its IUPAC name is 2-(1-adamantyl)-4-chloro-5-[[(1R,2R)-2-methylcyclohexyl]amino]pyridazin-3-one.
| Compound Name | 2-(1-adamantyl)-4-chloro-5-[[(1R,2R)-2-methylcyclohexyl]amino]pyridazin-3-one |
|---|---|
| PubChem CID | 7474065 |
| Molecular Formula | C21H30ClN3O |
| Molecular Weight | 375.94 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | 2-(1-adamantyl)-4-chloro-5-[[(1R,2R)-2-methylcyclohexyl]amino]pyridazin-3-one |
| SMILES | C[C@@H]1CCCC[C@H]1Nc1cnn(C23CC4CC(CC(C4)C2)C3)c(=O)c1Cl |
| InChI | InChI=1S/C21H30ClN3O/c1-13-4-2-3-5-17(13)24-18-12-23-25(20(26)19(18)22)21-9-14-6-15(10-21)8-16(7-14)11-21/h12-17,24H,2-11H2,1H3/t13-,14?,15?,16?,17-,21?/m1/s1 |
| InChIKey | COGHPZMQUJHMAS-RHEJXQKWSA-N |
| XLogP | 4.81 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.94 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |