C15H25N4O2S+ — CID 7474343
3-[(1-cyclopropyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methylideneamino]propyl-diethylazanium (PubChem CID 7474343) has the molecular formula C15H25N4O2S+ and a molecular weight of 325.46 g/mol. Its IUPAC name is 3-[(1-cyclopropyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methylideneamino]propyl-diethylazanium.
| Compound Name | 3-[(1-cyclopropyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methylideneamino]propyl-diethylazanium |
|---|---|
| PubChem CID | 7474343 |
| Molecular Formula | C15H25N4O2S+ |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 3-[(1-cyclopropyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methylideneamino]propyl-diethylazanium |
| SMILES | CC[NH+](CC)CCC/N=C/C1C(=O)NC(=S)N(C2CC2)C1=O |
| InChI | InChI=1S/C15H24N4O2S/c1-3-18(4-2)9-5-8-16-10-12-13(20)17-15(22)19(14(12)21)11-6-7-11/h10-12H,3-9H2,1-2H3,(H,17,20,22)/p+1/b16-10+ |
| InChIKey | DHHCINHAKTYFBA-MHWRWJLKSA-O |
| XLogP | -0.61 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|