C19H27N4O4S+ — CID 6998243
2-[[1-(2,5-dimethoxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl]methylideneamino]ethyl-diethylazanium (PubChem CID 6998243) has the molecular formula C19H27N4O4S+ and a molecular weight of 407.52 g/mol. Its IUPAC name is 2-[[1-(2,5-dimethoxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl]methylideneamino]ethyl-diethylazanium.
| Compound Name | 2-[[1-(2,5-dimethoxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl]methylideneamino]ethyl-diethylazanium |
|---|---|
| PubChem CID | 6998243 |
| Molecular Formula | C19H27N4O4S+ |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 2-[[1-(2,5-dimethoxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl]methylideneamino]ethyl-diethylazanium |
| SMILES | CC[NH+](CC)CC/N=C/C1C(=O)NC(=S)N(c2cc(OC)ccc2OC)C1=O |
| InChI | InChI=1S/C19H26N4O4S/c1-5-22(6-2)10-9-20-12-14-17(24)21-19(28)23(18(14)25)15-11-13(26-3)7-8-16(15)27-4/h7-8,11-12,14H,5-6,9-10H2,1-4H3,(H,21,24,28)/p+1/b20-12+ |
| InChIKey | JCEDRPGKXRUAPK-UDWIEESQSA-O |
| XLogP | 0.06 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|