C16H16N4O5 — CID 7474402
methyl (5S)-7-(3,5-dimethylphenyl)-1-nitroso-6,8-dioxo-1,2,7-triazaspiro[4.4]non-2-ene-3-carboxylate (PubChem CID 7474402) has the molecular formula C16H16N4O5 and a molecular weight of 344.33 g/mol. Its IUPAC name is methyl (5S)-7-(3,5-dimethylphenyl)-1-nitroso-6,8-dioxo-1,2,7-triazaspiro[4.4]non-2-ene-3-carboxylate.
| Compound Name | methyl (5S)-7-(3,5-dimethylphenyl)-1-nitroso-6,8-dioxo-1,2,7-triazaspiro[4.4]non-2-ene-3-carboxylate |
|---|---|
| PubChem CID | 7474402 |
| Molecular Formula | C16H16N4O5 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | methyl (5S)-7-(3,5-dimethylphenyl)-1-nitroso-6,8-dioxo-1,2,7-triazaspiro[4.4]non-2-ene-3-carboxylate |
| SMILES | COC(=O)C1=NN(N=O)[C@]2(CC(=O)N(c3cc(C)cc(C)c3)C2=O)C1 |
| InChI | InChI=1S/C16H16N4O5/c1-9-4-10(2)6-11(5-9)19-13(21)8-16(15(19)23)7-12(14(22)25-3)17-20(16)18-24/h4-6H,7-8H2,1-3H3/t16-/m0/s1 |
| InChIKey | PJGOUOSPWNQNOQ-INIZCTEOSA-N |
| XLogP | 1.22 |
| TPSA | 108.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|