C17H17N3O6 — CID 7493950
methyl (5R)-1-acetyl-7-(3-methoxyphenyl)-6,8-dioxo-1,2,7-triazaspiro[4.4]non-2-ene-3-carboxylate (PubChem CID 7493950) has the molecular formula C17H17N3O6 and a molecular weight of 359.34 g/mol. Its IUPAC name is methyl (5R)-1-acetyl-7-(3-methoxyphenyl)-6,8-dioxo-1,2,7-triazaspiro[4.4]non-2-ene-3-carboxylate.
| Compound Name | methyl (5R)-1-acetyl-7-(3-methoxyphenyl)-6,8-dioxo-1,2,7-triazaspiro[4.4]non-2-ene-3-carboxylate |
|---|---|
| PubChem CID | 7493950 |
| Molecular Formula | C17H17N3O6 |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | methyl (5R)-1-acetyl-7-(3-methoxyphenyl)-6,8-dioxo-1,2,7-triazaspiro[4.4]non-2-ene-3-carboxylate |
| SMILES | COC(=O)C1=NN(C(C)=O)[C@@]2(CC(=O)N(c3cccc(OC)c3)C2=O)C1 |
| InChI | InChI=1S/C17H17N3O6/c1-10(21)20-17(8-13(18-20)15(23)26-3)9-14(22)19(16(17)24)11-5-4-6-12(7-11)25-2/h4-7H,8-9H2,1-3H3/t17-/m1/s1 |
| InChIKey | JLDGVSQCJHFICB-QGZVFWFLSA-N |
| XLogP | 0.48 |
| TPSA | 105.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|