C18H19N3O5 — CID 3409842
ethyl 1-acetyl-7-(3-methylphenyl)-6,8-dioxo-1,2,7-triazaspiro[4.4]non-2-ene-3-carboxylate (PubChem CID 3409842) has the molecular formula C18H19N3O5 and a molecular weight of 357.37 g/mol. Its IUPAC name is ethyl 1-acetyl-7-(3-methylphenyl)-6,8-dioxo-1,2,7-triazaspiro[4.4]non-2-ene-3-carboxylate.
| Compound Name | ethyl 1-acetyl-7-(3-methylphenyl)-6,8-dioxo-1,2,7-triazaspiro[4.4]non-2-ene-3-carboxylate |
|---|---|
| PubChem CID | 3409842 |
| Molecular Formula | C18H19N3O5 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | ethyl 1-acetyl-7-(3-methylphenyl)-6,8-dioxo-1,2,7-triazaspiro[4.4]non-2-ene-3-carboxylate |
| SMILES | CCOC(=O)C1=NN(C(C)=O)C2(CC(=O)N(c3cccc(C)c3)C2=O)C1 |
| InChI | InChI=1S/C18H19N3O5/c1-4-26-16(24)14-9-18(21(19-14)12(3)22)10-15(23)20(17(18)25)13-7-5-6-11(2)8-13/h5-8H,4,9-10H2,1-3H3 |
| InChIKey | IMVHFCYIPZXMBP-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 96.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|