C14H24N4O5S — CID 7475178
1,3,4-trimethyl-N-(3-morpholin-4-ylpropyl)-2,6-dioxopyrimidine-5-sulfonamide (PubChem CID 7475178) has the molecular formula C14H24N4O5S and a molecular weight of 360.44 g/mol. Its IUPAC name is 1,3,4-trimethyl-N-(3-morpholin-4-ylpropyl)-2,6-dioxopyrimidine-5-sulfonamide.
| Compound Name | 1,3,4-trimethyl-N-(3-morpholin-4-ylpropyl)-2,6-dioxopyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 7475178 |
| Molecular Formula | C14H24N4O5S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 1,3,4-trimethyl-N-(3-morpholin-4-ylpropyl)-2,6-dioxopyrimidine-5-sulfonamide |
| SMILES | Cc1c(S(=O)(=O)NCCCN2CCOCC2)c(=O)n(C)c(=O)n1C |
| InChI | InChI=1S/C14H24N4O5S/c1-11-12(13(19)17(3)14(20)16(11)2)24(21,22)15-5-4-6-18-7-9-23-10-8-18/h15H,4-10H2,1-3H3 |
| InChIKey | RTIUMIZEUKXNAK-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 102.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|