C17H22N4O3S2 — CID 74763746
8-[[(2R)-2,3-diamino-3-oxopropyl]disulfanyl]-N-(2-methoxyethyl)-N-methylquinoline-4-carboxamide (PubChem CID 74763746) has the molecular formula C17H22N4O3S2 and a molecular weight of 394.52 g/mol. Its IUPAC name is 8-[[(2R)-2,3-diamino-3-oxopropyl]disulfanyl]-N-(2-methoxyethyl)-N-methylquinoline-4-carboxamide.
| Compound Name | 8-[[(2R)-2,3-diamino-3-oxopropyl]disulfanyl]-N-(2-methoxyethyl)-N-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 74763746 |
| Molecular Formula | C17H22N4O3S2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 8-[[(2R)-2,3-diamino-3-oxopropyl]disulfanyl]-N-(2-methoxyethyl)-N-methylquinoline-4-carboxamide |
| SMILES | COCCN(C)C(=O)c1ccnc2c(SSC[C@H](N)C(N)=O)cccc12 |
| InChI | InChI=1S/C17H22N4O3S2/c1-21(8-9-24-2)17(23)12-6-7-20-15-11(12)4-3-5-14(15)26-25-10-13(18)16(19)22/h3-7,13H,8-10,18H2,1-2H3,(H2,19,22)/t13-/m0/s1 |
| InChIKey | NOIUUXOVRBXLMS-ZDUSSCGKSA-N |
| XLogP | 1.51 |
| TPSA | 111.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|