C29H37Cl2N5O3 — CID 74767205
1-[4,5-dichloro-2-(3-methoxypropyl)phenyl]-3-[4-methyl-3-[2-(1-methylpiperidin-4-yl)ethoxy]-1-phenylpyrazol-5-yl]urea (PubChem CID 74767205) has the molecular formula C29H37Cl2N5O3 and a molecular weight of 574.55 g/mol. Its IUPAC name is 1-[4,5-dichloro-2-(3-methoxypropyl)phenyl]-3-[4-methyl-3-[2-(1-methylpiperidin-4-yl)ethoxy]-1-phenylpyrazol-5-yl]urea.
| Compound Name | 1-[4,5-dichloro-2-(3-methoxypropyl)phenyl]-3-[4-methyl-3-[2-(1-methylpiperidin-4-yl)ethoxy]-1-phenylpyrazol-5-yl]urea |
|---|---|
| PubChem CID | 74767205 |
| Molecular Formula | C29H37Cl2N5O3 |
| Molecular Weight | 574.55 g/mol |
| Exact Mass | 573.23 |
| IUPAC Name | 1-[4,5-dichloro-2-(3-methoxypropyl)phenyl]-3-[4-methyl-3-[2-(1-methylpiperidin-4-yl)ethoxy]-1-phenylpyrazol-5-yl]urea |
| SMILES | COCCCc1cc(Cl)c(Cl)cc1NC(=O)Nc1c(C)c(OCCC2CCN(C)CC2)nn1-c1ccccc1 |
| InChI | InChI=1S/C29H37Cl2N5O3/c1-20-27(33-29(37)32-26-19-25(31)24(30)18-22(26)8-7-16-38-3)36(23-9-5-4-6-10-23)34-28(20)39-17-13-21-11-14-35(2)15-12-21/h4-6,9-10,18-19,21H,7-8,11-17H2,1-3H3,(H2,32,33,37) |
| InChIKey | ILJKYLUXAFWTMK-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.55 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|