C27H34Cl3N5O3 — CID 74767444
1-[4,5-dichloro-2-(3-methoxypropyl)phenyl]-3-[4-methyl-1-phenyl-3-(piperidin-4-ylmethoxy)pyrazol-5-yl]urea;hydrochloride (PubChem CID 74767444) has the molecular formula C27H34Cl3N5O3 and a molecular weight of 582.96 g/mol. Its IUPAC name is 1-[4,5-dichloro-2-(3-methoxypropyl)phenyl]-3-[4-methyl-1-phenyl-3-(piperidin-4-ylmethoxy)pyrazol-5-yl]urea;hydrochloride.
| Compound Name | 1-[4,5-dichloro-2-(3-methoxypropyl)phenyl]-3-[4-methyl-1-phenyl-3-(piperidin-4-ylmethoxy)pyrazol-5-yl]urea;hydrochloride |
|---|---|
| PubChem CID | 74767444 |
| Molecular Formula | C27H34Cl3N5O3 |
| Molecular Weight | 582.96 g/mol |
| Exact Mass | 581.17 |
| IUPAC Name | 1-[4,5-dichloro-2-(3-methoxypropyl)phenyl]-3-[4-methyl-1-phenyl-3-(piperidin-4-ylmethoxy)pyrazol-5-yl]urea;hydrochloride |
| SMILES | COCCCc1cc(Cl)c(Cl)cc1NC(=O)Nc1c(C)c(OCC2CCNCC2)nn1-c1ccccc1.Cl |
| InChI | InChI=1S/C27H33Cl2N5O3.ClH/c1-18-25(32-27(35)31-24-16-23(29)22(28)15-20(24)7-6-14-36-2)34(21-8-4-3-5-9-21)33-26(18)37-17-19-10-12-30-13-11-19;/h3-5,8-9,15-16,19,30H,6-7,10-14,17H2,1-2H3,(H2,31,32,35);1H |
| InChIKey | RBYVDWWQWVLGHN-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 89.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.96 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|