C27H33Cl2N5O3 — CID 74767280
1-[4,5-dichloro-2-(3-methoxypropyl)phenyl]-3-[4-methyl-3-(1-methylpiperidin-4-yl)oxy-1-phenylpyrazol-5-yl]urea (PubChem CID 74767280) has the molecular formula C27H33Cl2N5O3 and a molecular weight of 546.50 g/mol. Its IUPAC name is 1-[4,5-dichloro-2-(3-methoxypropyl)phenyl]-3-[4-methyl-3-(1-methylpiperidin-4-yl)oxy-1-phenylpyrazol-5-yl]urea.
| Compound Name | 1-[4,5-dichloro-2-(3-methoxypropyl)phenyl]-3-[4-methyl-3-(1-methylpiperidin-4-yl)oxy-1-phenylpyrazol-5-yl]urea |
|---|---|
| PubChem CID | 74767280 |
| Molecular Formula | C27H33Cl2N5O3 |
| Molecular Weight | 546.50 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | 1-[4,5-dichloro-2-(3-methoxypropyl)phenyl]-3-[4-methyl-3-(1-methylpiperidin-4-yl)oxy-1-phenylpyrazol-5-yl]urea |
| SMILES | COCCCc1cc(Cl)c(Cl)cc1NC(=O)Nc1c(C)c(OC2CCN(C)CC2)nn1-c1ccccc1 |
| InChI | InChI=1S/C27H33Cl2N5O3/c1-18-25(31-27(35)30-24-17-23(29)22(28)16-19(24)8-7-15-36-3)34(20-9-5-4-6-10-20)32-26(18)37-21-11-13-33(2)14-12-21/h4-6,9-10,16-17,21H,7-8,11-15H2,1-3H3,(H2,30,31,35) |
| InChIKey | QRPKOIZVNBPNAQ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.50 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|