C26H31Cl2N5O4 — CID 74767530
1-[4,5-dichloro-2-(3-methoxypropyl)phenyl]-3-[4-methyl-3-[[(2R)-morpholin-2-yl]methoxy]-1-phenylpyrazol-5-yl]urea (PubChem CID 74767530) has the molecular formula C26H31Cl2N5O4 and a molecular weight of 548.47 g/mol. Its IUPAC name is 1-[4,5-dichloro-2-(3-methoxypropyl)phenyl]-3-[4-methyl-3-[[(2R)-morpholin-2-yl]methoxy]-1-phenylpyrazol-5-yl]urea.
| Compound Name | 1-[4,5-dichloro-2-(3-methoxypropyl)phenyl]-3-[4-methyl-3-[[(2R)-morpholin-2-yl]methoxy]-1-phenylpyrazol-5-yl]urea |
|---|---|
| PubChem CID | 74767530 |
| Molecular Formula | C26H31Cl2N5O4 |
| Molecular Weight | 548.47 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | 1-[4,5-dichloro-2-(3-methoxypropyl)phenyl]-3-[4-methyl-3-[[(2R)-morpholin-2-yl]methoxy]-1-phenylpyrazol-5-yl]urea |
| SMILES | COCCCc1cc(Cl)c(Cl)cc1NC(=O)Nc1c(C)c(OC[C@H]2CNCCO2)nn1-c1ccccc1 |
| InChI | InChI=1S/C26H31Cl2N5O4/c1-17-24(31-26(34)30-23-14-22(28)21(27)13-18(23)7-6-11-35-2)33(19-8-4-3-5-9-19)32-25(17)37-16-20-15-29-10-12-36-20/h3-5,8-9,13-14,20,29H,6-7,10-12,15-16H2,1-2H3,(H2,30,31,34)/t20-/m1/s1 |
| InChIKey | MIAPWZBKQNHRJZ-HXUWFJFHSA-N |
| XLogP | 5.08 |
| TPSA | 98.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.47 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|