C17H18BrN6O3+ — CID 74770248
8-(5-bromo-2-methoxyphenyl)-5-ethyl-1,3-dimethyl-4aH-purino[8,9-c][1,2,4]triazol-1-ium-2,4-dione (PubChem CID 74770248) has the molecular formula C17H18BrN6O3+ and a molecular weight of 434.27 g/mol. Its IUPAC name is 8-(5-bromo-2-methoxyphenyl)-5-ethyl-1,3-dimethyl-4aH-purino[8,9-c][1,2,4]triazol-1-ium-2,4-dione.
| Compound Name | 8-(5-bromo-2-methoxyphenyl)-5-ethyl-1,3-dimethyl-4aH-purino[8,9-c][1,2,4]triazol-1-ium-2,4-dione |
|---|---|
| PubChem CID | 74770248 |
| Molecular Formula | C17H18BrN6O3+ |
| Molecular Weight | 434.27 g/mol |
| Exact Mass | 433.06 |
| IUPAC Name | 8-(5-bromo-2-methoxyphenyl)-5-ethyl-1,3-dimethyl-4aH-purino[8,9-c][1,2,4]triazol-1-ium-2,4-dione |
| SMILES | CCN1c2nnc(-c3cc(Br)ccc3OC)n2C2=[N+](C)C(=O)N(C)C(=O)C21 |
| InChI | InChI=1S/C17H18BrN6O3/c1-5-23-12-14(21(2)17(26)22(3)15(12)25)24-13(19-20-16(23)24)10-8-9(18)6-7-11(10)27-4/h6-8,12H,5H2,1-4H3/q+1 |
| InChIKey | GMJRFAUNZGKQIJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 83.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.27 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|