C19H23BrN6O3 — CID 74770236
8-(5-bromo-2-methoxyphenyl)-1-methyl-5-(3-methylbutyl)-4a,9a-dihydropurino[8,9-c][1,2,4]triazole-2,4-dione (PubChem CID 74770236) has the molecular formula C19H23BrN6O3 and a molecular weight of 463.34 g/mol. Its IUPAC name is 8-(5-bromo-2-methoxyphenyl)-1-methyl-5-(3-methylbutyl)-4a,9a-dihydropurino[8,9-c][1,2,4]triazole-2,4-dione.
| Compound Name | 8-(5-bromo-2-methoxyphenyl)-1-methyl-5-(3-methylbutyl)-4a,9a-dihydropurino[8,9-c][1,2,4]triazole-2,4-dione |
|---|---|
| PubChem CID | 74770236 |
| Molecular Formula | C19H23BrN6O3 |
| Molecular Weight | 463.34 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 8-(5-bromo-2-methoxyphenyl)-1-methyl-5-(3-methylbutyl)-4a,9a-dihydropurino[8,9-c][1,2,4]triazole-2,4-dione |
| SMILES | COc1ccc(Br)cc1-c1nnc2n1C1C(C(=O)NC(=O)N1C)N2CCC(C)C |
| InChI | InChI=1S/C19H23BrN6O3/c1-10(2)7-8-25-14-16(27)21-19(28)24(3)17(14)26-15(22-23-18(25)26)12-9-11(20)5-6-13(12)29-4/h5-6,9-10,14,17H,7-8H2,1-4H3,(H,21,27,28) |
| InChIKey | RMSFVYGRGWHJDM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |