C21H33N5O3S — CID 74777205
N-[3-(4-phenylpiperazin-1-yl)sulfonylpropyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide (PubChem CID 74777205) has the molecular formula C21H33N5O3S and a molecular weight of 435.59 g/mol. Its IUPAC name is N-[3-(4-phenylpiperazin-1-yl)sulfonylpropyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide.
| Compound Name | N-[3-(4-phenylpiperazin-1-yl)sulfonylpropyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 74777205 |
| Molecular Formula | C21H33N5O3S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | N-[3-(4-phenylpiperazin-1-yl)sulfonylpropyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide |
| SMILES | O=C(NCCCS(=O)(=O)N1CCN(c2ccccc2)CC1)C1NNC2CCCCC21 |
| InChI | InChI=1S/C21H33N5O3S/c27-21(20-18-9-4-5-10-19(18)23-24-20)22-11-6-16-30(28,29)26-14-12-25(13-15-26)17-7-2-1-3-8-17/h1-3,7-8,18-20,23-24H,4-6,9-16H2,(H,22,27) |
| InChIKey | HPBMIRPIVBZTLZ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|