C14H14N4O2S — CID 747947
8-benzylsulfanyl-3,7-dimethylpurine-2,6-dione (PubChem CID 747947) has the molecular formula C14H14N4O2S and a molecular weight of 302.36 g/mol. Its IUPAC name is 8-benzylsulfanyl-3,7-dimethylpurine-2,6-dione.
| Compound Name | 8-benzylsulfanyl-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 747947 |
| Molecular Formula | C14H14N4O2S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 8-benzylsulfanyl-3,7-dimethylpurine-2,6-dione |
| SMILES | Cn1c(SCc2ccccc2)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C14H14N4O2S/c1-17-10-11(18(2)13(20)16-12(10)19)15-14(17)21-8-9-6-4-3-5-7-9/h3-7H,8H2,1-2H3,(H,16,19,20) |
| InChIKey | QHTLERFLGQXGHQ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |