C21H24F2N4O — CID 74809267
[3-(4-fluoroanilino)piperidin-1-yl]-[3-(3-fluorophenyl)pyrazolidin-4-yl]methanone (PubChem CID 74809267) has the molecular formula C21H24F2N4O and a molecular weight of 386.45 g/mol. Its IUPAC name is [3-(4-fluoroanilino)piperidin-1-yl]-[3-(3-fluorophenyl)pyrazolidin-4-yl]methanone.
| Compound Name | [3-(4-fluoroanilino)piperidin-1-yl]-[3-(3-fluorophenyl)pyrazolidin-4-yl]methanone |
|---|---|
| PubChem CID | 74809267 |
| Molecular Formula | C21H24F2N4O |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | [3-(4-fluoroanilino)piperidin-1-yl]-[3-(3-fluorophenyl)pyrazolidin-4-yl]methanone |
| SMILES | O=C(C1CNNC1c1cccc(F)c1)N1CCCC(Nc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C21H24F2N4O/c22-15-6-8-17(9-7-15)25-18-5-2-10-27(13-18)21(28)19-12-24-26-20(19)14-3-1-4-16(23)11-14/h1,3-4,6-9,11,18-20,24-26H,2,5,10,12-13H2 |
| InChIKey | WLYVMASUNVJWPW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |