C16H11N2O4- — CID 7481893
3-[(4Z)-4-(furan-2-ylmethylidene)-3-methyl-5-oxopyrazol-1-yl]benzoate (PubChem CID 7481893) has the molecular formula C16H11N2O4- and a molecular weight of 295.27 g/mol. Its IUPAC name is 3-[(4Z)-4-(furan-2-ylmethylidene)-3-methyl-5-oxopyrazol-1-yl]benzoate.
| Compound Name | 3-[(4Z)-4-(furan-2-ylmethylidene)-3-methyl-5-oxopyrazol-1-yl]benzoate |
|---|---|
| PubChem CID | 7481893 |
| Molecular Formula | C16H11N2O4- |
| Molecular Weight | 295.27 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 3-[(4Z)-4-(furan-2-ylmethylidene)-3-methyl-5-oxopyrazol-1-yl]benzoate |
| SMILES | CC1=NN(c2cccc(C(=O)[O-])c2)C(=O)/C1=C\c1ccco1 |
| InChI | InChI=1S/C16H12N2O4/c1-10-14(9-13-6-3-7-22-13)15(19)18(17-10)12-5-2-4-11(8-12)16(20)21/h2-9H,1H3,(H,20,21)/p-1/b14-9- |
| InChIKey | AJVPWHWNMOSOJG-ZROIWOOFSA-M |
| XLogP | 1.45 |
| TPSA | 85.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.27 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|