About 4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undeca-2,4-diene
4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undeca-2,4-diene (PubChem CID 74819450) has the molecular formula C15H22
and a molecular weight of 202.34 g/mol. Its IUPAC name is 4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undeca-2,4-diene.
Analyze 4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undeca-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undeca-2,4-diene?
The IUPAC name of 4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undeca-2,4-diene (CID 74819450) is 4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undeca-2,4-diene.
What is the SMILES notation for 4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undeca-2,4-diene?
The canonical SMILES for 4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undeca-2,4-diene is CC1=C2CC3CCC(C)C2(C=C1)C3(C)C.
What is the InChIKey of 4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undeca-2,4-diene?
The InChIKey is DPHLFUXQEZYZAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22/c1-10-7-8-15-11(2)5-6-12(9-13(10)15)14(15,3)4/h7-8,11-12H,5-6,9H2,1-4H3.
What are the key properties of 4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undeca-2,4-diene?
4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undeca-2,4-diene has a molecular weight of 202.34 g/mol, XLogP of 4.34, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undeca-2,4-diene is sourced from PubChem (CID 74819450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).