C18H24N2O5S — CID 7482063
propyl (2R,4S)-3-(4-methyl-3-nitrobenzoyl)-2-propan-2-yl-1,3-thiazolidine-4-carboxylate (PubChem CID 7482063) has the molecular formula C18H24N2O5S and a molecular weight of 380.47 g/mol. Its IUPAC name is propyl (2R,4S)-3-(4-methyl-3-nitrobenzoyl)-2-propan-2-yl-1,3-thiazolidine-4-carboxylate.
| Compound Name | propyl (2R,4S)-3-(4-methyl-3-nitrobenzoyl)-2-propan-2-yl-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 7482063 |
| Molecular Formula | C18H24N2O5S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | propyl (2R,4S)-3-(4-methyl-3-nitrobenzoyl)-2-propan-2-yl-1,3-thiazolidine-4-carboxylate |
| SMILES | CCCOC(=O)[C@H]1CS[C@H](C(C)C)N1C(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H24N2O5S/c1-5-8-25-18(22)15-10-26-17(11(2)3)19(15)16(21)13-7-6-12(4)14(9-13)20(23)24/h6-7,9,11,15,17H,5,8,10H2,1-4H3/t15-,17-/m1/s1 |
| InChIKey | SHHIDEWGCBQPCP-NVXWUHKLSA-N |
| XLogP | 3.40 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|