C20H18N2O5S — CID 7482980
N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methylphenyl]-2-oxochromene-3-carboxamide (PubChem CID 7482980) has the molecular formula C20H18N2O5S and a molecular weight of 398.44 g/mol. Its IUPAC name is N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methylphenyl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methylphenyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 7482980 |
| Molecular Formula | C20H18N2O5S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methylphenyl]-2-oxochromene-3-carboxamide |
| SMILES | Cc1cc(N2CCCS2(=O)=O)ccc1NC(=O)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C20H18N2O5S/c1-13-11-15(22-9-4-10-28(22,25)26)7-8-17(13)21-19(23)16-12-14-5-2-3-6-18(14)27-20(16)24/h2-3,5-8,11-12H,4,9-10H2,1H3,(H,21,23) |
| InChIKey | BAGPWBNTTWAWEX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|