C19H23N3O5S — CID 7488682
[2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] (E)-2-cyano-3-[4-(dimethylamino)phenyl]prop-2-enoate (PubChem CID 7488682) has the molecular formula C19H23N3O5S and a molecular weight of 405.48 g/mol. Its IUPAC name is [2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] (E)-2-cyano-3-[4-(dimethylamino)phenyl]prop-2-enoate.
| Compound Name | [2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] (E)-2-cyano-3-[4-(dimethylamino)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 7488682 |
| Molecular Formula | C19H23N3O5S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | [2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] (E)-2-cyano-3-[4-(dimethylamino)phenyl]prop-2-enoate |
| SMILES | CN(C)c1ccc(/C=C(\C#N)C(=O)OCC(=O)N(C)[C@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C19H23N3O5S/c1-21(2)16-6-4-14(5-7-16)10-15(11-20)19(24)27-12-18(23)22(3)17-8-9-28(25,26)13-17/h4-7,10,17H,8-9,12-13H2,1-3H3/b15-10+/t17-/m0/s1 |
| InChIKey | AAAWSHDPPHCEMX-OBHPCNEJSA-N |
| XLogP | 0.85 |
| TPSA | 107.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|