C21H26N2O5S — CID 8880830
[2-[[(3R)-1,1-dioxothiolan-3-yl]-(2-methylpropyl)amino]-2-oxoethyl] (E)-2-cyano-3-(4-methylphenyl)prop-2-enoate (PubChem CID 8880830) has the molecular formula C21H26N2O5S and a molecular weight of 418.52 g/mol. Its IUPAC name is [2-[[(3R)-1,1-dioxothiolan-3-yl]-(2-methylpropyl)amino]-2-oxoethyl] (E)-2-cyano-3-(4-methylphenyl)prop-2-enoate.
| Compound Name | [2-[[(3R)-1,1-dioxothiolan-3-yl]-(2-methylpropyl)amino]-2-oxoethyl] (E)-2-cyano-3-(4-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8880830 |
| Molecular Formula | C21H26N2O5S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | [2-[[(3R)-1,1-dioxothiolan-3-yl]-(2-methylpropyl)amino]-2-oxoethyl] (E)-2-cyano-3-(4-methylphenyl)prop-2-enoate |
| SMILES | Cc1ccc(/C=C(\C#N)C(=O)OCC(=O)N(CC(C)C)[C@@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C21H26N2O5S/c1-15(2)12-23(19-8-9-29(26,27)14-19)20(24)13-28-21(25)18(11-22)10-17-6-4-16(3)5-7-17/h4-7,10,15,19H,8-9,12-14H2,1-3H3/b18-10+/t19-/m1/s1 |
| InChIKey | QKZKGAOVROVZIZ-SZVPOVDMSA-N |
| XLogP | 2.12 |
| TPSA | 104.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|