C7H9N3 — CID 74891844
6-ethenylpyridine-3,4-diamine (PubChem CID 74891844) has the molecular formula C7H9N3 and a molecular weight of 135.17 g/mol. Its IUPAC name is 6-ethenylpyridine-3,4-diamine.
| Compound Name | 6-ethenylpyridine-3,4-diamine |
|---|---|
| PubChem CID | 74891844 |
| Molecular Formula | C7H9N3 |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.08 |
| IUPAC Name | 6-ethenylpyridine-3,4-diamine |
| SMILES | C=Cc1cc(N)c(N)cn1 |
| InChI | InChI=1S/C7H9N3/c1-2-5-3-6(8)7(9)4-10-5/h2-4H,1,9H2,(H2,8,10) |
| InChIKey | LCSVBGDQNJYMLE-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |