C19H11N3OS — CID 74892449
N-(7-cyano-1,3-benzothiazol-2-yl)naphthalene-2-carboxamide (PubChem CID 74892449) has the molecular formula C19H11N3OS and a molecular weight of 329.38 g/mol. Its IUPAC name is N-(7-cyano-1,3-benzothiazol-2-yl)naphthalene-2-carboxamide.
| Compound Name | N-(7-cyano-1,3-benzothiazol-2-yl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 74892449 |
| Molecular Formula | C19H11N3OS |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | N-(7-cyano-1,3-benzothiazol-2-yl)naphthalene-2-carboxamide |
| SMILES | N#Cc1cccc2nc(NC(=O)c3ccc4ccccc4c3)sc12 |
| InChI | InChI=1S/C19H11N3OS/c20-11-15-6-3-7-16-17(15)24-19(21-16)22-18(23)14-9-8-12-4-1-2-5-13(12)10-14/h1-10H,(H,21,22,23) |
| InChIKey | HLUYJCRLUOURJL-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |