C21H19F3N2OS — CID 7490204
6-methyl-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]thiochromen-4-one (PubChem CID 7490204) has the molecular formula C21H19F3N2OS and a molecular weight of 404.46 g/mol. Its IUPAC name is 6-methyl-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]thiochromen-4-one.
| Compound Name | 6-methyl-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]thiochromen-4-one |
|---|---|
| PubChem CID | 7490204 |
| Molecular Formula | C21H19F3N2OS |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 6-methyl-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]thiochromen-4-one |
| SMILES | Cc1ccc2scc(N3CCN(c4cccc(C(F)(F)F)c4)CC3)c(=O)c2c1 |
| InChI | InChI=1S/C21H19F3N2OS/c1-14-5-6-19-17(11-14)20(27)18(13-28-19)26-9-7-25(8-10-26)16-4-2-3-15(12-16)21(22,23)24/h2-6,11-13H,7-10H2,1H3 |
| InChIKey | BNNIMDMQJVFIIT-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |