C20H25FN2O2S2 — CID 7491212
N-cyclohexyl-6-[(1R)-1-(4-fluorophenyl)ethyl]sulfanyl-N-methylpyridine-3-sulfonamide (PubChem CID 7491212) has the molecular formula C20H25FN2O2S2 and a molecular weight of 408.56 g/mol. Its IUPAC name is N-cyclohexyl-6-[(1R)-1-(4-fluorophenyl)ethyl]sulfanyl-N-methylpyridine-3-sulfonamide.
| Compound Name | N-cyclohexyl-6-[(1R)-1-(4-fluorophenyl)ethyl]sulfanyl-N-methylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 7491212 |
| Molecular Formula | C20H25FN2O2S2 |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | N-cyclohexyl-6-[(1R)-1-(4-fluorophenyl)ethyl]sulfanyl-N-methylpyridine-3-sulfonamide |
| SMILES | C[C@@H](Sc1ccc(S(=O)(=O)N(C)C2CCCCC2)cn1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H25FN2O2S2/c1-15(16-8-10-17(21)11-9-16)26-20-13-12-19(14-22-20)27(24,25)23(2)18-6-4-3-5-7-18/h8-15,18H,3-7H2,1-2H3/t15-/m1/s1 |
| InChIKey | NBVVWENULCEJLA-OAHLLOKOSA-N |
| XLogP | 5.03 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |