C21H28N2O3S2 — CID 7491182
N-cyclohexyl-N-methyl-6-[2-(4-methylphenoxy)ethylsulfanyl]pyridine-3-sulfonamide (PubChem CID 7491182) has the molecular formula C21H28N2O3S2 and a molecular weight of 420.60 g/mol. Its IUPAC name is N-cyclohexyl-N-methyl-6-[2-(4-methylphenoxy)ethylsulfanyl]pyridine-3-sulfonamide.
| Compound Name | N-cyclohexyl-N-methyl-6-[2-(4-methylphenoxy)ethylsulfanyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 7491182 |
| Molecular Formula | C21H28N2O3S2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | N-cyclohexyl-N-methyl-6-[2-(4-methylphenoxy)ethylsulfanyl]pyridine-3-sulfonamide |
| SMILES | Cc1ccc(OCCSc2ccc(S(=O)(=O)N(C)C3CCCCC3)cn2)cc1 |
| InChI | InChI=1S/C21H28N2O3S2/c1-17-8-10-19(11-9-17)26-14-15-27-21-13-12-20(16-22-21)28(24,25)23(2)18-6-4-3-5-7-18/h8-13,16,18H,3-7,14-15H2,1-2H3 |
| InChIKey | RTMIYXVVDAGQRD-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|