C18H24N4O3S2 — CID 16617457
6-[(E)-4-amino-3-cyano-2-oxopent-3-enyl]sulfanyl-N-cyclohexyl-N-methylpyridine-3-sulfonamide (PubChem CID 16617457) has the molecular formula C18H24N4O3S2 and a molecular weight of 408.55 g/mol. Its IUPAC name is 6-[(E)-4-amino-3-cyano-2-oxopent-3-enyl]sulfanyl-N-cyclohexyl-N-methylpyridine-3-sulfonamide.
| Compound Name | 6-[(E)-4-amino-3-cyano-2-oxopent-3-enyl]sulfanyl-N-cyclohexyl-N-methylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 16617457 |
| Molecular Formula | C18H24N4O3S2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 6-[(E)-4-amino-3-cyano-2-oxopent-3-enyl]sulfanyl-N-cyclohexyl-N-methylpyridine-3-sulfonamide |
| SMILES | C/C(N)=C(/C#N)C(=O)CSc1ccc(S(=O)(=O)N(C)C2CCCCC2)cn1 |
| InChI | InChI=1S/C18H24N4O3S2/c1-13(20)16(10-19)17(23)12-26-18-9-8-15(11-21-18)27(24,25)22(2)14-6-4-3-5-7-14/h8-9,11,14H,3-7,12,20H2,1-2H3/b16-13+ |
| InChIKey | XZEAPJMSQCWAAB-DTQAZKPQSA-N |
| XLogP | 2.45 |
| TPSA | 117.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|