C17H25N3O5S2 — CID 7774962
ethyl N-[2-[[5-[cyclohexyl(methyl)sulfamoyl]-2-pyridinyl]sulfanyl]acetyl]carbamate (PubChem CID 7774962) has the molecular formula C17H25N3O5S2 and a molecular weight of 415.54 g/mol. Its IUPAC name is ethyl N-[2-[[5-[cyclohexyl(methyl)sulfamoyl]-2-pyridinyl]sulfanyl]acetyl]carbamate.
| Compound Name | ethyl N-[2-[[5-[cyclohexyl(methyl)sulfamoyl]-2-pyridinyl]sulfanyl]acetyl]carbamate |
|---|---|
| PubChem CID | 7774962 |
| Molecular Formula | C17H25N3O5S2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | ethyl N-[2-[[5-[cyclohexyl(methyl)sulfamoyl]-2-pyridinyl]sulfanyl]acetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)CSc1ccc(S(=O)(=O)N(C)C2CCCCC2)cn1 |
| InChI | InChI=1S/C17H25N3O5S2/c1-3-25-17(22)19-15(21)12-26-16-10-9-14(11-18-16)27(23,24)20(2)13-7-5-4-6-8-13/h9-11,13H,3-8,12H2,1-2H3,(H,19,21,22) |
| InChIKey | RRGILZANWTTXFY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |