C24H34N2O3S2 — CID 24530973
6-[2-(1-adamantyl)-2-oxoethyl]sulfanyl-N-cyclohexyl-N-methylpyridine-3-sulfonamide (PubChem CID 24530973) has the molecular formula C24H34N2O3S2 and a molecular weight of 462.68 g/mol. Its IUPAC name is 6-[2-(1-adamantyl)-2-oxoethyl]sulfanyl-N-cyclohexyl-N-methylpyridine-3-sulfonamide.
| Compound Name | 6-[2-(1-adamantyl)-2-oxoethyl]sulfanyl-N-cyclohexyl-N-methylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 24530973 |
| Molecular Formula | C24H34N2O3S2 |
| Molecular Weight | 462.68 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | 6-[2-(1-adamantyl)-2-oxoethyl]sulfanyl-N-cyclohexyl-N-methylpyridine-3-sulfonamide |
| SMILES | CN(C1CCCCC1)S(=O)(=O)c1ccc(SCC(=O)C23CC4CC(CC(C4)C2)C3)nc1 |
| InChI | InChI=1S/C24H34N2O3S2/c1-26(20-5-3-2-4-6-20)31(28,29)21-7-8-23(25-15-21)30-16-22(27)24-12-17-9-18(13-24)11-19(10-17)14-24/h7-8,15,17-20H,2-6,9-14,16H2,1H3 |
| InChIKey | QQFWWFUZBIUAPO-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.68 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |