C18H22FN3O2S2 — CID 25409396
1-[[6-[(1R)-1-(4-fluorophenyl)ethyl]sulfanyl-3-pyridinyl]sulfonyl]-4-methylpiperazine (PubChem CID 25409396) has the molecular formula C18H22FN3O2S2 and a molecular weight of 395.53 g/mol. Its IUPAC name is 1-[[6-[(1R)-1-(4-fluorophenyl)ethyl]sulfanyl-3-pyridinyl]sulfonyl]-4-methylpiperazine.
| Compound Name | 1-[[6-[(1R)-1-(4-fluorophenyl)ethyl]sulfanyl-3-pyridinyl]sulfonyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 25409396 |
| Molecular Formula | C18H22FN3O2S2 |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 1-[[6-[(1R)-1-(4-fluorophenyl)ethyl]sulfanyl-3-pyridinyl]sulfonyl]-4-methylpiperazine |
| SMILES | C[C@@H](Sc1ccc(S(=O)(=O)N2CCN(C)CC2)cn1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H22FN3O2S2/c1-14(15-3-5-16(19)6-4-15)25-18-8-7-17(13-20-18)26(23,24)22-11-9-21(2)10-12-22/h3-8,13-14H,9-12H2,1-2H3/t14-/m1/s1 |
| InChIKey | JPSREXVYJWJZPM-CQSZACIVSA-N |
| XLogP | 3.01 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |