C14H21N5O4S2 — CID 43031074
N-carbamoyl-2-[[5-(4-methylpiperazin-1-yl)sulfonyl-2-pyridinyl]sulfanyl]propanamide (PubChem CID 43031074) has the molecular formula C14H21N5O4S2 and a molecular weight of 387.49 g/mol. Its IUPAC name is N-carbamoyl-2-[[5-(4-methylpiperazin-1-yl)sulfonyl-2-pyridinyl]sulfanyl]propanamide.
| Compound Name | N-carbamoyl-2-[[5-(4-methylpiperazin-1-yl)sulfonyl-2-pyridinyl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 43031074 |
| Molecular Formula | C14H21N5O4S2 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | N-carbamoyl-2-[[5-(4-methylpiperazin-1-yl)sulfonyl-2-pyridinyl]sulfanyl]propanamide |
| SMILES | CC(Sc1ccc(S(=O)(=O)N2CCN(C)CC2)cn1)C(=O)NC(N)=O |
| InChI | InChI=1S/C14H21N5O4S2/c1-10(13(20)17-14(15)21)24-12-4-3-11(9-16-12)25(22,23)19-7-5-18(2)6-8-19/h3-4,9-10H,5-8H2,1-2H3,(H3,15,17,20,21) |
| InChIKey | HGNVRBKOHIXQQE-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 125.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |