C15H22N4O4S2 — CID 7594090
(2S)-N-carbamoyl-3-methyl-2-[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]butanamide (PubChem CID 7594090) has the molecular formula C15H22N4O4S2 and a molecular weight of 386.50 g/mol. Its IUPAC name is (2S)-N-carbamoyl-3-methyl-2-[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]butanamide.
| Compound Name | (2S)-N-carbamoyl-3-methyl-2-[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]butanamide |
|---|---|
| PubChem CID | 7594090 |
| Molecular Formula | C15H22N4O4S2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | (2S)-N-carbamoyl-3-methyl-2-[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]butanamide |
| SMILES | CC(C)[C@H](Sc1ccc(S(=O)(=O)N2CCCC2)cn1)C(=O)NC(N)=O |
| InChI | InChI=1S/C15H22N4O4S2/c1-10(2)13(14(20)18-15(16)21)24-12-6-5-11(9-17-12)25(22,23)19-7-3-4-8-19/h5-6,9-10,13H,3-4,7-8H2,1-2H3,(H3,16,18,20,21)/t13-/m0/s1 |
| InChIKey | YJNWLYOAOCPXQI-ZDUSSCGKSA-N |
| XLogP | 1.18 |
| TPSA | 122.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |