C38H37Cl4N3O4 — CID 74953213
benzyl 1'-[3-(3,4-dichlorophenyl)-5-[(3,5-dichlorophenyl)methoxy]-4-hydroxyiminopentyl]spiro[2H-indole-3,4'-piperidine]-1-carboxylate (PubChem CID 74953213) has the molecular formula C38H37Cl4N3O4 and a molecular weight of 741.54 g/mol. Its IUPAC name is benzyl 1'-[3-(3,4-dichlorophenyl)-5-[(3,5-dichlorophenyl)methoxy]-4-hydroxyiminopentyl]spiro[2H-indole-3,4'-piperidine]-1-carboxylate.
| Compound Name | benzyl 1'-[3-(3,4-dichlorophenyl)-5-[(3,5-dichlorophenyl)methoxy]-4-hydroxyiminopentyl]spiro[2H-indole-3,4'-piperidine]-1-carboxylate |
|---|---|
| PubChem CID | 74953213 |
| Molecular Formula | C38H37Cl4N3O4 |
| Molecular Weight | 741.54 g/mol |
| Exact Mass | 739.15 |
| IUPAC Name | benzyl 1'-[3-(3,4-dichlorophenyl)-5-[(3,5-dichlorophenyl)methoxy]-4-hydroxyiminopentyl]spiro[2H-indole-3,4'-piperidine]-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CC2(CCN(CCC(C(COCc3cc(Cl)cc(Cl)c3)=NO)c3ccc(Cl)c(Cl)c3)CC2)c2ccccc21 |
| InChI | InChI=1S/C38H37Cl4N3O4/c39-29-18-27(19-30(40)21-29)22-48-24-35(43-47)31(28-10-11-33(41)34(42)20-28)12-15-44-16-13-38(14-17-44)25-45(36-9-5-4-8-32(36)38)37(46)49-23-26-6-2-1-3-7-26/h1-11,18-21,31,47H,12-17,22-25H2 |
| InChIKey | PMKMFNPNPHUDOT-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.54 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|