C37H39Cl2F6NO5 — CID 162547086
methyl 3-[(Z)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-(3,4-dichlorophenyl)-6-(4-hydroxy-4-phenylpiperidin-1-yl)hex-2-enoxy]propanoate (PubChem CID 162547086) has the molecular formula C37H39Cl2F6NO5 and a molecular weight of 762.61 g/mol. Its IUPAC name is methyl 3-[(Z)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-(3,4-dichlorophenyl)-6-(4-hydroxy-4-phenylpiperidin-1-yl)hex-2-enoxy]propanoate.
| Compound Name | methyl 3-[(Z)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-(3,4-dichlorophenyl)-6-(4-hydroxy-4-phenylpiperidin-1-yl)hex-2-enoxy]propanoate |
|---|---|
| PubChem CID | 162547086 |
| Molecular Formula | C37H39Cl2F6NO5 |
| Molecular Weight | 762.61 g/mol |
| Exact Mass | 761.21 |
| IUPAC Name | methyl 3-[(Z)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-(3,4-dichlorophenyl)-6-(4-hydroxy-4-phenylpiperidin-1-yl)hex-2-enoxy]propanoate |
| SMILES | COC(=O)CCOC/C=C(\COCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(CCN1CCC(O)(c2ccccc2)CC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C37H39Cl2F6NO5/c1-49-34(47)11-18-50-17-10-27(24-51-23-25-19-29(36(40,41)42)22-30(20-25)37(43,44)45)31(26-7-8-32(38)33(39)21-26)9-14-46-15-12-35(48,13-16-46)28-5-3-2-4-6-28/h2-8,10,19-22,31,48H,9,11-18,23-24H2,1H3/b27-10+ |
| InChIKey | UHVNKTFRZQZFJQ-YPXUMCKCSA-N |
| XLogP | 9.21 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.61 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|