C29H30Cl2F2N2O2 — CID 163856889
1-[3-(3,4-dichlorophenyl)-5-[(2,4-difluorophenyl)methoxy]-4-iminopentyl]-4-phenylpiperidin-4-ol (PubChem CID 163856889) has the molecular formula C29H30Cl2F2N2O2 and a molecular weight of 547.47 g/mol. Its IUPAC name is 1-[3-(3,4-dichlorophenyl)-5-[(2,4-difluorophenyl)methoxy]-4-iminopentyl]-4-phenylpiperidin-4-ol.
| Compound Name | 1-[3-(3,4-dichlorophenyl)-5-[(2,4-difluorophenyl)methoxy]-4-iminopentyl]-4-phenylpiperidin-4-ol |
|---|---|
| PubChem CID | 163856889 |
| Molecular Formula | C29H30Cl2F2N2O2 |
| Molecular Weight | 547.47 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | 1-[3-(3,4-dichlorophenyl)-5-[(2,4-difluorophenyl)methoxy]-4-iminopentyl]-4-phenylpiperidin-4-ol |
| SMILES | [H]/N=C(\COCc1ccc(F)cc1F)C(CCN1CCC(O)(c2ccccc2)CC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C29H30Cl2F2N2O2/c30-25-9-7-20(16-26(25)31)24(28(34)19-37-18-21-6-8-23(32)17-27(21)33)10-13-35-14-11-29(36,12-15-35)22-4-2-1-3-5-22/h1-9,16-17,24,34,36H,10-15,18-19H2/b34-28+ |
| InChIKey | OZBGQILUCCYTRG-CDSHQWRTSA-N |
| XLogP | 6.97 |
| TPSA | 56.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.47 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|