C31H28Cl2F6N2O3 — CID 162547082
[3-(3,4-dichlorophenyl)-5-(4-hydroxy-4-phenylpiperidin-1-yl)-2-iminopentyl] 3,5-bis(trifluoromethyl)benzoate (PubChem CID 162547082) has the molecular formula C31H28Cl2F6N2O3 and a molecular weight of 661.47 g/mol. Its IUPAC name is [3-(3,4-dichlorophenyl)-5-(4-hydroxy-4-phenylpiperidin-1-yl)-2-iminopentyl] 3,5-bis(trifluoromethyl)benzoate.
| Compound Name | [3-(3,4-dichlorophenyl)-5-(4-hydroxy-4-phenylpiperidin-1-yl)-2-iminopentyl] 3,5-bis(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 162547082 |
| Molecular Formula | C31H28Cl2F6N2O3 |
| Molecular Weight | 661.47 g/mol |
| Exact Mass | 660.14 |
| IUPAC Name | [3-(3,4-dichlorophenyl)-5-(4-hydroxy-4-phenylpiperidin-1-yl)-2-iminopentyl] 3,5-bis(trifluoromethyl)benzoate |
| SMILES | [H]/N=C(\COC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(CCN1CCC(O)(c2ccccc2)CC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C31H28Cl2F6N2O3/c32-25-7-6-19(16-26(25)33)24(8-11-41-12-9-29(43,10-13-41)21-4-2-1-3-5-21)27(40)18-44-28(42)20-14-22(30(34,35)36)17-23(15-20)31(37,38)39/h1-7,14-17,24,40,43H,8-13,18H2/b40-27+ |
| InChIKey | NHZDDVNHHZCVFQ-WOQJSSNBSA-N |
| XLogP | 8.37 |
| TPSA | 73.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.47 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|