C32H38BrCl2N3O6S — CID 177496089
4-bromo-N-[(2E)-3-(3,4-dichlorophenyl)-5-(4-hydroxy-4-phenylpiperidin-1-yl)-2-methoxyiminopentyl]-3,5-dimethoxy-N-methylbenzenesulfonamide (PubChem CID 177496089) has the molecular formula C32H38BrCl2N3O6S and a molecular weight of 743.55 g/mol. Its IUPAC name is 4-bromo-N-[(2E)-3-(3,4-dichlorophenyl)-5-(4-hydroxy-4-phenylpiperidin-1-yl)-2-methoxyiminopentyl]-3,5-dimethoxy-N-methylbenzenesulfonamide.
| Compound Name | 4-bromo-N-[(2E)-3-(3,4-dichlorophenyl)-5-(4-hydroxy-4-phenylpiperidin-1-yl)-2-methoxyiminopentyl]-3,5-dimethoxy-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 177496089 |
| Molecular Formula | C32H38BrCl2N3O6S |
| Molecular Weight | 743.55 g/mol |
| Exact Mass | 741.10 |
| IUPAC Name | 4-bromo-N-[(2E)-3-(3,4-dichlorophenyl)-5-(4-hydroxy-4-phenylpiperidin-1-yl)-2-methoxyiminopentyl]-3,5-dimethoxy-N-methylbenzenesulfonamide |
| SMILES | CO/N=C(/CN(C)S(=O)(=O)c1cc(OC)c(Br)c(OC)c1)C(CCN1CCC(O)(c2ccccc2)CC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C32H38BrCl2N3O6S/c1-37(45(40,41)24-19-29(42-2)31(33)30(20-24)43-3)21-28(36-44-4)25(22-10-11-26(34)27(35)18-22)12-15-38-16-13-32(39,14-17-38)23-8-6-5-7-9-23/h5-11,18-20,25,39H,12-17,21H2,1-4H3/b36-28- |
| InChIKey | FJYNPGICUQCMHN-DKJXEYTPSA-N |
| XLogP | 6.55 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.55 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|