C30H37Cl4N5O3 — CID 91580411
3,5-dichloro-N-[(2E,3R)-3-(3,4-dichlorophenyl)-2-methoxyimino-5-[4-(3-methyl-2-oxo-1,3-diazinan-1-yl)piperidin-1-yl]pentyl]-N-methylbenzamide (PubChem CID 91580411) has the molecular formula C30H37Cl4N5O3 and a molecular weight of 657.47 g/mol. Its IUPAC name is 3,5-dichloro-N-[(2E,3R)-3-(3,4-dichlorophenyl)-2-methoxyimino-5-[4-(3-methyl-2-oxo-1,3-diazinan-1-yl)piperidin-1-yl]pentyl]-N-methylbenzamide.
| Compound Name | 3,5-dichloro-N-[(2E,3R)-3-(3,4-dichlorophenyl)-2-methoxyimino-5-[4-(3-methyl-2-oxo-1,3-diazinan-1-yl)piperidin-1-yl]pentyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 91580411 |
| Molecular Formula | C30H37Cl4N5O3 |
| Molecular Weight | 657.47 g/mol |
| Exact Mass | 655.17 |
| IUPAC Name | 3,5-dichloro-N-[(2E,3R)-3-(3,4-dichlorophenyl)-2-methoxyimino-5-[4-(3-methyl-2-oxo-1,3-diazinan-1-yl)piperidin-1-yl]pentyl]-N-methylbenzamide |
| SMILES | CO/N=C(/CN(C)C(=O)c1cc(Cl)cc(Cl)c1)[C@H](CCN1CCC(N2CCCN(C)C2=O)CC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C30H37Cl4N5O3/c1-36-10-4-11-39(30(36)41)24-7-12-38(13-8-24)14-9-25(20-5-6-26(33)27(34)17-20)28(35-42-3)19-37(2)29(40)21-15-22(31)18-23(32)16-21/h5-6,15-18,24-25H,4,7-14,19H2,1-3H3/b35-28-/t25-/m1/s1 |
| InChIKey | CWMJXUYOMKBSDT-KLIQBFEHSA-N |
| XLogP | 6.77 |
| TPSA | 68.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.47 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|